C28H37FN6O3S — CID 174085160
2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(2-methylpropyl)piperazin-1-yl]sulfonyl-3-(2-methoxyethylimino)prop-1-en-1-amine (PubChem CID 174085160) has the molecular formula C28H37FN6O3S and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(2-methylpropyl)piperazin-1-yl]sulfonyl-3-(2-methoxyethylimino)prop-1-en-1-amine.
| Compound Name | 2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(2-methylpropyl)piperazin-1-yl]sulfonyl-3-(2-methoxyethylimino)prop-1-en-1-amine |
|---|---|
| PubChem CID | 174085160 |
| Molecular Formula | C28H37FN6O3S |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 2-[(3S)-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-4-(2-methylpropyl)piperazin-1-yl]sulfonyl-3-(2-methoxyethylimino)prop-1-en-1-amine |
| SMILES | COCC/N=C/C(=CN)S(=O)(=O)N1CCN(CC(C)C)[C@@H](c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C28H37FN6O3S/c1-20(2)18-33-10-11-34(39(36,37)25(15-30)17-31-9-12-38-4)19-28(33)26-14-22-16-32-35(27(22)13-21(26)3)24-7-5-23(29)6-8-24/h5-8,13-17,20,28H,9-12,18-19,30H2,1-4H3/b25-15?,31-17+/t28-/m1/s1 |
| InChIKey | YLYQRYSPRFAZPE-VVROXMFBSA-N |
| XLogP | 3.63 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|