C18H19F3N6 — CID 174085169
6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-2,8-diamine (PubChem CID 174085169) has the molecular formula C18H19F3N6 and a molecular weight of 376.39 g/mol. Its IUPAC name is 6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-2,8-diamine.
| Compound Name | 6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-2,8-diamine |
|---|---|
| PubChem CID | 174085169 |
| Molecular Formula | C18H19F3N6 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-2,8-diamine |
| SMILES | [H]/N=C/C(=C(N)C(F)(F)F)c1nc2ccc(N)c(/C=N/[H])c2c2c1CC(N)CC2 |
| InChI | InChI=1S/C18H19F3N6/c19-18(20,21)17(26)12(7-23)16-10-5-8(24)1-2-9(10)15-11(6-22)13(25)3-4-14(15)27-16/h3-4,6-8,22-23H,1-2,5,24-26H2/b17-12?,22-6+,23-7+ |
| InChIKey | MNCSWVGKEMFCST-HOIZJYMYSA-N |
| XLogP | 2.51 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|