C19H17F3N6 — CID 174085188
2-amino-6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carbonitrile (PubChem CID 174085188) has the molecular formula C19H17F3N6 and a molecular weight of 386.38 g/mol. Its IUPAC name is 2-amino-6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carbonitrile.
| Compound Name | 2-amino-6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carbonitrile |
|---|---|
| PubChem CID | 174085188 |
| Molecular Formula | C19H17F3N6 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-amino-6-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carbonitrile |
| SMILES | [H]/N=C/C(=C(N)C(F)(F)F)c1nc2ccc(N)c(/C=N/[H])c2c2c1CC(C#N)CC2 |
| InChI | InChI=1S/C19H17F3N6/c20-19(21,22)18(27)13(8-25)17-11-5-9(6-23)1-2-10(11)16-12(7-24)14(26)3-4-15(16)28-17/h3-4,7-9,24-25H,1-2,5,26-27H2/b18-13?,24-7+,25-8+ |
| InChIKey | MSOIPWJXYRUCKU-ULAXNNLCSA-N |
| XLogP | 3.32 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|