About CID 174085345
CID 174085345 (PubChem CID 174085345) has the molecular formula C53H49BN5S
and a molecular weight of 798.89 g/mol.
Molecular Properties
| Compound Name | CID 174085345 |
| PubChem CID | 174085345 |
| Molecular Formula | C53H49BN5S |
| Molecular Weight | 798.89 g/mol |
| Exact Mass | 798.38 |
| IUPAC Name | — |
| SMILES | C=C/C=C\C(=C/C)c1nc(C(/C=C\C)=C/C=C)nc(-c2cccc(-n3c(C)c(/C=C(\C=C)c4ccc5c(c4)-c4c(ccc6ncsc46)C5(C)C)c(/C=C\[B]C)c3C=C)c2)n1 |
| InChI | InChI=1S/C53H49BN5S/c1-11-17-21-35(14-4)50-56-51(37(19-12-2)20-13-3)58-52(57-50)39-22-18-23-40(30-39)59-34(7)42(41(28-29-54-10)47(59)16-6)31-36(15-5)38-24-25-44-43(32-38)48-45(53(44,8)9)26-27-46-49(48)60-33-55-46/h11-33H,1-2,5-6H2,3-4,7-10H3/b20-13-,21-17-,29-28-,35-14+,36-31+,37-19+ |
| InChIKey | IBBDLSTVPXSSPH-GJFJJNGYSA-N |
| XLogP | 13.94 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 798.89 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 174085345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174085345?
The IUPAC name of CID 174085345 (CID 174085345) is not available.
What is the SMILES notation for CID 174085345?
The canonical SMILES for CID 174085345 is C=C/C=C\C(=C/C)c1nc(C(/C=C\C)=C/C=C)nc(-c2cccc(-n3c(C)c(/C=C(\C=C)c4ccc5c(c4)-c4c(ccc6ncsc46)C5(C)C)c(/C=C\[B]C)c3C=C)c2)n1.
What is the InChIKey of CID 174085345?
The InChIKey is IBBDLSTVPXSSPH-GJFJJNGYSA-N. The full InChI is InChI=1S/C53H49BN5S/c1-11-17-21-35(14-4)50-56-51(37(19-12-2)20-13-3)58-52(57-50)39-22-18-23-40(30-39)59-34(7)42(41(28-29-54-10)47(59)16-6)31-36(15-5)38-24-25-44-43(32-38)48-45(53(44,8)9)26-27-46-49(48)60-33-55-46/h11-33H,1-2,5-6H2,3-4,7-10H3/b20-13-,21-17-,29-28-,35-14+,36-31+,37-19+.
What are the key properties of CID 174085345?
CID 174085345 has a molecular weight of 798.89 g/mol, XLogP of 13.94, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174085345 is sourced from PubChem (CID 174085345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).