C12H20ClF3 — CID 174085420
(4R,5S,6S,7S)-3-chloro-8,8,8-trifluoro-4,5,6,7-tetramethyloct-1-ene (PubChem CID 174085420) has the molecular formula C12H20ClF3 and a molecular weight of 256.74 g/mol. Its IUPAC name is (4R,5S,6S,7S)-3-chloro-8,8,8-trifluoro-4,5,6,7-tetramethyloct-1-ene.
| Compound Name | (4R,5S,6S,7S)-3-chloro-8,8,8-trifluoro-4,5,6,7-tetramethyloct-1-ene |
|---|---|
| PubChem CID | 174085420 |
| Molecular Formula | C12H20ClF3 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (4R,5S,6S,7S)-3-chloro-8,8,8-trifluoro-4,5,6,7-tetramethyloct-1-ene |
| SMILES | C=CC(Cl)[C@H](C)[C@@H](C)[C@H](C)[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C12H20ClF3/c1-6-11(13)9(4)7(2)8(3)10(5)12(14,15)16/h6-11H,1H2,2-5H3/t7-,8-,9+,10-,11?/m0/s1 |
| InChIKey | QQQSGTLHQDWXNA-GEPHSGDCSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|