C32H35B2ClO4 — CID 174085686
2-[4-[[7-(2-chlorophenyl)phenanthren-2-yl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174085686) has the molecular formula C32H35B2ClO4 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-[4-[[7-(2-chlorophenyl)phenanthren-2-yl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[[7-(2-chlorophenyl)phenanthren-2-yl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174085686 |
| Molecular Formula | C32H35B2ClO4 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[4-[[7-(2-chlorophenyl)phenanthren-2-yl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(Cc3ccc4c(ccc5cc(-c6ccccc6Cl)ccc54)c3)O2)OC1(C)C |
| InChI | InChI=1S/C32H35B2ClO4/c1-29(2)30(3,4)37-33(36-29)34-38-31(5,6)32(7,39-34)20-21-12-16-25-22(18-21)13-14-23-19-24(15-17-26(23)25)27-10-8-9-11-28(27)35/h8-19H,20H2,1-7H3 |
| InChIKey | SRBSWKNWBQLBOP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|