C12H26N3Si+ — CID 174086468
2-(4,6-dimethyl-3-propyl-2H-1,3,2-diazasilin-3-ium-1-yl)-N,N-dimethylethanamine (PubChem CID 174086468) has the molecular formula C12H26N3Si+ and a molecular weight of 240.45 g/mol. Its IUPAC name is 2-(4,6-dimethyl-3-propyl-2H-1,3,2-diazasilin-3-ium-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(4,6-dimethyl-3-propyl-2H-1,3,2-diazasilin-3-ium-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 174086468 |
| Molecular Formula | C12H26N3Si+ |
| Molecular Weight | 240.45 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-(4,6-dimethyl-3-propyl-2H-1,3,2-diazasilin-3-ium-1-yl)-N,N-dimethylethanamine |
| SMILES | CCC[N+]1=C(C)C=C(C)N(CCN(C)C)[SiH2]1 |
| InChI | InChI=1S/C12H26N3Si/c1-6-7-14-11(2)10-12(3)15(16-14)9-8-13(4)5/h10H,6-9,16H2,1-5H3/q+1 |
| InChIKey | OMCLLDSXVCBHKM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|