C9H16BNO4 — CID 174086649
(5R)-5-formyl-N,N-dimethyl-2-propyl-1,3,2-dioxaborolane-4-carboxamide (PubChem CID 174086649) has the molecular formula C9H16BNO4 and a molecular weight of 213.04 g/mol. Its IUPAC name is (5R)-5-formyl-N,N-dimethyl-2-propyl-1,3,2-dioxaborolane-4-carboxamide.
| Compound Name | (5R)-5-formyl-N,N-dimethyl-2-propyl-1,3,2-dioxaborolane-4-carboxamide |
|---|---|
| PubChem CID | 174086649 |
| Molecular Formula | C9H16BNO4 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (5R)-5-formyl-N,N-dimethyl-2-propyl-1,3,2-dioxaborolane-4-carboxamide |
| SMILES | CCCB1OC(C(=O)N(C)C)[C@H](C=O)O1 |
| InChI | InChI=1S/C9H16BNO4/c1-4-5-10-14-7(6-12)8(15-10)9(13)11(2)3/h6-8H,4-5H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | RDDFGBSSBOCXBB-JAMMHHFISA-N |
| XLogP | -0.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|