C18H28N4O2Si — CID 174086681
7-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylideneoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 174086681) has the molecular formula C18H28N4O2Si and a molecular weight of 360.53 g/mol. Its IUPAC name is 7-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylideneoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylideneoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 174086681 |
| Molecular Formula | C18H28N4O2Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 7-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylideneoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C=C1O[C@@H](c2ccc3c(N)ncnn23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C18H28N4O2Si/c1-11-12(2)23-16(15(11)24-25(6,7)18(3,4)5)13-8-9-14-17(19)20-10-21-22(13)14/h8-11,15-16H,2H2,1,3-7H3,(H2,19,20,21)/t11-,15-,16+/m1/s1 |
| InChIKey | CJWMRIXUYLSJAU-LYRGGWFBSA-N |
| XLogP | 3.92 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|