C37H71N12+ — CID 174086771
7,16,25,34-tetraethyl-37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 174086771) has the molecular formula C37H71N12+ and a molecular weight of 684.06 g/mol. Its IUPAC name is 7,16,25,34-tetraethyl-37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 7,16,25,34-tetraethyl-37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 174086771 |
| Molecular Formula | C37H71N12+ |
| Molecular Weight | 684.06 g/mol |
| Exact Mass | 683.59 |
| IUPAC Name | 7,16,25,34-tetraethyl-37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CCC1CNC2C3NC(NC4NC(NC5C6NCC(CC)CC6C(NC6NC(N3)C3CC(CC)CNC63)[NH+]5C)C3CC(CC)CNC43)C2C1 |
| InChI | InChI=1S/C37H70N12/c1-6-18-10-22-26(38-14-18)33-42-30(22)43-34-27-24(12-20(8-3)15-39-27)32(46-34)47-37-29-25(13-21(9-4)17-41-29)36(49(37)5)48-35-28-23(31(44-33)45-35)11-19(7-2)16-40-28/h18-48H,6-17H2,1-5H3/p+1 |
| InChIKey | KGMDNWWXUYREIX-UHFFFAOYSA-O |
| XLogP | -1.68 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.06 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 11 |