C29H55N12+ — CID 174086775
37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 174086775) has the molecular formula C29H55N12+ and a molecular weight of 571.84 g/mol. Its IUPAC name is 37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 174086775 |
| Molecular Formula | C29H55N12+ |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.47 |
| IUPAC Name | 37-methyl-2,5,11,14,20,23,29,32,38,39,40-undecaza-37-azonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C[NH+]1C2NC3NC(NC4NC(NC5NC(NC1C1NCCCC12)C1CCCNC51)C1CCCNC41)C1CCCNC31 |
| InChI | InChI=1S/C29H54N12/c1-41-28-17-9-5-13-33-21(17)29(41)39-24-16-8-4-11-31-19(16)26(38-24)35-22-14-6-2-10-30-18(14)25(34-22)36-23-15-7-3-12-32-20(15)27(37-23)40-28/h14-40H,2-13H2,1H3/p+1 |
| InChIKey | UZLOCATXGMFANU-UHFFFAOYSA-O |
| XLogP | -4.22 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 11 |