C61H118N12O8S4 — CID 174086791
7,16,25,34-tetrakis(2-ethylhexylsulfonyl)-37-methyl-2,5,11,14,20,23,29,32,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 174086791) has the molecular formula C61H118N12O8S4 and a molecular weight of 1275.96 g/mol. Its IUPAC name is 7,16,25,34-tetrakis(2-ethylhexylsulfonyl)-37-methyl-2,5,11,14,20,23,29,32,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 7,16,25,34-tetrakis(2-ethylhexylsulfonyl)-37-methyl-2,5,11,14,20,23,29,32,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 174086791 |
| Molecular Formula | C61H118N12O8S4 |
| Molecular Weight | 1275.96 g/mol |
| Exact Mass | 1274.81 |
| IUPAC Name | 7,16,25,34-tetrakis(2-ethylhexylsulfonyl)-37-methyl-2,5,11,14,20,23,29,32,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CCCCC(CC)CS(=O)(=O)C1CNC2C3NC(NC4NC(NC5C6NCC(S(=O)(=O)CC(CC)CCCC)CC6C(NC6NC(N3)C3CC(S(=O)(=O)CC(CC)CCCC)CNC63)N5C)C3CC(S(=O)(=O)CC(CC)CCCC)CNC43)C2C1 |
| InChI | InChI=1S/C61H118N12O8S4/c1-10-18-22-38(14-5)34-82(74,75)42-26-46-50(62-30-42)57-66-54(46)67-58-51-48(28-44(31-63-51)84(78,79)36-40(16-7)24-20-12-3)56(70-58)71-61-53-49(29-45(33-65-53)85(80,81)37-41(17-8)25-21-13-4)60(73(61)9)72-59-52-47(55(68-57)69-59)27-43(32-64-52)83(76,77)35-39(15-6)23-19-11-2/h38-72H,10-37H2,1-9H3 |
| InChIKey | BQLGIHNTQKJOSK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 272.13 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 20 |