C13H21F2NO2 — CID 174086850
ethyl 2-fluoro-3-[(2R,3S,8S)-2-fluoro-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]propanoate (PubChem CID 174086850) has the molecular formula C13H21F2NO2 and a molecular weight of 261.31 g/mol. Its IUPAC name is ethyl 2-fluoro-3-[(2R,3S,8S)-2-fluoro-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]propanoate.
| Compound Name | ethyl 2-fluoro-3-[(2R,3S,8S)-2-fluoro-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]propanoate |
|---|---|
| PubChem CID | 174086850 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | ethyl 2-fluoro-3-[(2R,3S,8S)-2-fluoro-3-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]propanoate |
| SMILES | CCOC(=O)C(F)C[C@@]12CCCN1[C@@H](C)[C@H](F)C2 |
| InChI | InChI=1S/C13H21F2NO2/c1-3-18-12(17)11(15)8-13-5-4-6-16(13)9(2)10(14)7-13/h9-11H,3-8H2,1-2H3/t9-,10+,11?,13-/m0/s1 |
| InChIKey | SURDHDZBXFVVIE-LMSJBEHQSA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |