C20H40B2O6 — CID 174086982
4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxy]-5-[2-[4,5,5-trimethyl-2-(2-methylpropoxy)-1,3,2-dioxaborolan-4-yl]ethyl]-1,3,2-dioxaborolane (PubChem CID 174086982) has the molecular formula C20H40B2O6 and a molecular weight of 398.16 g/mol. Its IUPAC name is 4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxy]-5-[2-[4,5,5-trimethyl-2-(2-methylpropoxy)-1,3,2-dioxaborolan-4-yl]ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxy]-5-[2-[4,5,5-trimethyl-2-(2-methylpropoxy)-1,3,2-dioxaborolan-4-yl]ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174086982 |
| Molecular Formula | C20H40B2O6 |
| Molecular Weight | 398.16 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxy]-5-[2-[4,5,5-trimethyl-2-(2-methylpropoxy)-1,3,2-dioxaborolan-4-yl]ethyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)COB1OC(C)(C)C(C)(CCC2(C)OB(OC(C)(C)C)OC2(C)C)O1 |
| InChI | InChI=1S/C20H40B2O6/c1-15(2)14-23-21-25-17(6,7)19(10,27-21)12-13-20(11)18(8,9)26-22(28-20)24-16(3,4)5/h15H,12-14H2,1-11H3 |
| InChIKey | NPNXLOZRFJHWHZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|