C27H24FN6O2Si — CID 174087484
CID 174087484 (PubChem CID 174087484) has the molecular formula C27H24FN6O2Si and a molecular weight of 511.61 g/mol.
| Compound Name | CID 174087484 |
|---|---|
| PubChem CID | 174087484 |
| Molecular Formula | C27H24FN6O2Si |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | — |
| SMILES | Cn1cc(C(=O)N[Si](C)c2cccc(F)c2)c2cc(-c3ccc4nc(NC(=O)C5CC5)nn4c3)ccc21 |
| InChI | InChI=1S/C27H24FN6O2Si/c1-33-15-22(26(36)32-37(2)20-5-3-4-19(28)13-20)21-12-17(8-10-23(21)33)18-9-11-24-29-27(31-34(24)14-18)30-25(35)16-6-7-16/h3-5,8-16H,6-7H2,1-2H3,(H,32,36)(H,30,31,35) |
| InChIKey | JXPJHFOODUIORW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|