C22H23BFN5O — CID 174087569
CID 174087569 (PubChem CID 174087569) has the molecular formula C22H23BFN5O and a molecular weight of 403.27 g/mol.
| Compound Name | CID 174087569 |
|---|---|
| PubChem CID | 174087569 |
| Molecular Formula | C22H23BFN5O |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | — |
| SMILES | [B]c1cc2nc(C(=O)N3CC(F)c4ccccc4[C@H]3CC)cc(N3CCCC3)n2n1 |
| InChI | InChI=1S/C22H23BFN5O/c1-2-18-15-8-4-3-7-14(15)16(24)13-28(18)22(30)17-11-21(27-9-5-6-10-27)29-20(25-17)12-19(23)26-29/h3-4,7-8,11-12,16,18H,2,5-6,9-10,13H2,1H3/t16?,18-/m1/s1 |
| InChIKey | VPHDOHORROKGAO-UHUGOGIASA-N |
| XLogP | 2.74 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|