C26H28BFN6 — CID 174087798
[[1-[6-[4-amino-3-(methyliminomethyl)phenyl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]-[1-(2-fluoroethyl)cyclopropyl]boranyl]formonitrile (PubChem CID 174087798) has the molecular formula C26H28BFN6 and a molecular weight of 454.36 g/mol. Its IUPAC name is [[1-[6-[4-amino-3-(methyliminomethyl)phenyl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]-[1-(2-fluoroethyl)cyclopropyl]boranyl]formonitrile.
| Compound Name | [[1-[6-[4-amino-3-(methyliminomethyl)phenyl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]-[1-(2-fluoroethyl)cyclopropyl]boranyl]formonitrile |
|---|---|
| PubChem CID | 174087798 |
| Molecular Formula | C26H28BFN6 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [[1-[6-[4-amino-3-(methyliminomethyl)phenyl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]-[1-(2-fluoroethyl)cyclopropyl]boranyl]formonitrile |
| SMILES | C/N=C/c1cc(-c2ccc3nc(N4CCC(B(C#N)C5(CCF)CC5)C4)ccc3n2)ccc1N |
| InChI | InChI=1S/C26H28BFN6/c1-31-15-19-14-18(2-3-21(19)30)22-4-5-24-23(32-22)6-7-25(33-24)34-13-8-20(16-34)27(17-29)26(9-10-26)11-12-28/h2-7,14-15,20H,8-13,16,30H2,1H3/b31-15+ |
| InChIKey | DHPCYQRECTYMCK-IBBHUPRXSA-N |
| XLogP | 4.96 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|