About (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine
(4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine (PubChem CID 174088559) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine |
| PubChem CID | 174088559 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine |
| SMILES | CCC1=C(N)N=CC[C@H]1C |
| InChI | InChI=1S/C8H14N2/c1-3-7-6(2)4-5-10-8(7)9/h5-6H,3-4,9H2,1-2H3/t6-/m1/s1 |
| InChIKey | BSBMYSKDWOKVIH-ZCFIWIBFSA-N |
| XLogP | 1.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine?
The IUPAC name of (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine (CID 174088559) is (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine.
What is the SMILES notation for (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine?
The canonical SMILES for (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine is CCC1=C(N)N=CC[C@H]1C.
What is the InChIKey of (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine?
The InChIKey is BSBMYSKDWOKVIH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-7-6(2)4-5-10-8(7)9/h5-6H,3-4,9H2,1-2H3/t6-/m1/s1.
What are the key properties of (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine?
(4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine has a molecular weight of 138.21 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-ethyl-4-methyl-3,4-dihydropyridin-6-amine is sourced from PubChem (CID 174088559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).