C19H27BO4 — CID 174089313
2-[2-(ethoxymethoxy)-4-prop-1-ynylphenyl]-4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolane (PubChem CID 174089313) has the molecular formula C19H27BO4 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[2-(ethoxymethoxy)-4-prop-1-ynylphenyl]-4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(ethoxymethoxy)-4-prop-1-ynylphenyl]-4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174089313 |
| Molecular Formula | C19H27BO4 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[2-(ethoxymethoxy)-4-prop-1-ynylphenyl]-4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolane |
| SMILES | CC#Cc1ccc(B2OC(C)(C)C(C)(CC)O2)c(OCOCC)c1 |
| InChI | InChI=1S/C19H27BO4/c1-7-10-15-11-12-16(17(13-15)22-14-21-9-3)20-23-18(4,5)19(6,8-2)24-20/h11-13H,8-9,14H2,1-6H3 |
| InChIKey | LTSGSCCEUAKZIU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|