C59H34B5NO — CID 174089341
CID 174089341 (PubChem CID 174089341) has the molecular formula C59H34B5NO and a molecular weight of 826.99 g/mol.
| Compound Name | CID 174089341 |
|---|---|
| PubChem CID | 174089341 |
| Molecular Formula | C59H34B5NO |
| Molecular Weight | 826.99 g/mol |
| Exact Mass | 827.31 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)c3c2oc2ccccc23)c([B])c1[B] |
| InChI | InChI=1S/C59H34B5NO/c60-53-52(54(61)56(63)57(64)55(53)62)46-32-33-49(51-45-22-10-12-25-50(45)66-58(46)51)65(39-28-26-36(27-29-39)42-23-13-15-35-14-7-8-20-41(35)42)40-30-31-44-43-21-9-11-24-47(43)59(48(44)34-40,37-16-3-1-4-17-37)38-18-5-2-6-19-38/h1-34H |
| InChIKey | CIYXZCLOKVKNSB-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.99 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|