C35H41F3N3O4Si — CID 174089736
CID 174089736 (PubChem CID 174089736) has the molecular formula C35H41F3N3O4Si and a molecular weight of 652.81 g/mol.
| Compound Name | CID 174089736 |
|---|---|
| PubChem CID | 174089736 |
| Molecular Formula | C35H41F3N3O4Si |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | — |
| SMILES | Cc1cc(=O)n([C@H](C(=O)CC[C@@H](CC(=O)O)c2cc(-c3c(C)cccc3C)cc(F)c2F)C([Si])C(C)C)nc1CCN1CC(F)C1 |
| InChI | InChI=1S/C35H41F3N3O4Si/c1-19(2)35(46)34(41-30(43)13-22(5)28(39-41)11-12-40-17-25(36)18-40)29(42)10-9-23(16-31(44)45)26-14-24(15-27(37)33(26)38)32-20(3)7-6-8-21(32)4/h6-8,13-15,19,23,25,34-35H,9-12,16-18H2,1-5H3,(H,44,45)/t23-,34+,35?/m0/s1 |
| InChIKey | HXSLXLSUKYSNHW-CMBMJQNSSA-N |
| XLogP | 6.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|