About (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide
(3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide (PubChem CID 174089882) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide.
Molecular Properties
| Compound Name | (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide |
| PubChem CID | 174089882 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide |
| SMILES | C=C/N=C(\N)C[C@H](C)C(CC)CCNC |
| InChI | InChI=1S/C12H25N3/c1-5-11(7-8-14-4)10(3)9-12(13)15-6-2/h6,10-11,14H,2,5,7-9H2,1,3-4H3,(H2,13,15)/t10-,11?/m0/s1 |
| InChIKey | GVBKSUJFGUXBDW-VUWPPUDQSA-N |
| XLogP | 2.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide?
The IUPAC name of (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide (CID 174089882) is (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide.
What is the SMILES notation for (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide?
The canonical SMILES for (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide is C=C/N=C(\N)C[C@H](C)C(CC)CCNC.
What is the InChIKey of (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide?
The InChIKey is GVBKSUJFGUXBDW-VUWPPUDQSA-N. The full InChI is InChI=1S/C12H25N3/c1-5-11(7-8-14-4)10(3)9-12(13)15-6-2/h6,10-11,14H,2,5,7-9H2,1,3-4H3,(H2,13,15)/t10-,11?/m0/s1.
What are the key properties of (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide?
(3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide has a molecular weight of 211.35 g/mol, XLogP of 2.15, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N'-ethenyl-4-ethyl-3-methyl-6-(methylamino)hexanimidamide is sourced from PubChem (CID 174089882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).