C18H26N2O5 — CID 174089924
methyl (3S,9aR)-8-methyl-6-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]-5-oxo-1,2,3,6,7,9a-hexahydropyrrolo[1,2-a]azepine-3-carboxylate (PubChem CID 174089924) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl (3S,9aR)-8-methyl-6-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]-5-oxo-1,2,3,6,7,9a-hexahydropyrrolo[1,2-a]azepine-3-carboxylate.
| Compound Name | methyl (3S,9aR)-8-methyl-6-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]-5-oxo-1,2,3,6,7,9a-hexahydropyrrolo[1,2-a]azepine-3-carboxylate |
|---|---|
| PubChem CID | 174089924 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl (3S,9aR)-8-methyl-6-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]-5-oxo-1,2,3,6,7,9a-hexahydropyrrolo[1,2-a]azepine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H]2C=C(C)CC(C=NC(=O)OC(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C18H26N2O5/c1-11-8-12(10-19-17(23)25-18(2,3)4)15(21)20-13(9-11)6-7-14(20)16(22)24-5/h9-10,12-14H,6-8H2,1-5H3/t12?,13-,14+/m1/s1 |
| InChIKey | BGGAOQQWWKGLSB-IUZLNWEFSA-N |
| XLogP | 2.49 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|