C43H61BN2 — CID 174090916
11-(cyclohexen-1-yl)-5-cyclohexyl-8-(3-cyclohexylcyclohexa-2,4-dien-1-yl)-16-ethenyl-15-propan-2-yl-8,14-diaza-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-4,9(17),10-triene (PubChem CID 174090916) has the molecular formula C43H61BN2 and a molecular weight of 616.79 g/mol. Its IUPAC name is 11-(cyclohexen-1-yl)-5-cyclohexyl-8-(3-cyclohexylcyclohexa-2,4-dien-1-yl)-16-ethenyl-15-propan-2-yl-8,14-diaza-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-4,9(17),10-triene.
| Compound Name | 11-(cyclohexen-1-yl)-5-cyclohexyl-8-(3-cyclohexylcyclohexa-2,4-dien-1-yl)-16-ethenyl-15-propan-2-yl-8,14-diaza-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-4,9(17),10-triene |
|---|---|
| PubChem CID | 174090916 |
| Molecular Formula | C43H61BN2 |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.49 |
| IUPAC Name | 11-(cyclohexen-1-yl)-5-cyclohexyl-8-(3-cyclohexylcyclohexa-2,4-dien-1-yl)-16-ethenyl-15-propan-2-yl-8,14-diaza-1-boratetracyclo[7.7.1.02,7.013,17]heptadeca-4,9(17),10-triene |
| SMILES | C=CC1B2C3=C(C=C(C4=CCCCC4)CC3NC1C(C)C)N(C1C=C(C3CCCCC3)C=CC1)C1CC(C3CCCCC3)=CCC21 |
| InChI | InChI=1S/C43H61BN2/c1-4-37-43(29(2)3)45-39-26-35(32-19-12-7-13-20-32)28-41-42(39)44(37)38-24-23-34(31-17-10-6-11-18-31)27-40(38)46(41)36-22-14-21-33(25-36)30-15-8-5-9-16-30/h4,14,19,21,23,25,28-31,36-40,43,45H,1,5-13,15-18,20,22,24,26-27H2,2-3H3 |
| InChIKey | UBOSXZIEKCYCLK-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|