C11H22FN — CID 174091403
(3S,4R)-3-ethenyl-2-fluoro-N,4,5-trimethylhexan-1-amine (PubChem CID 174091403) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is (3S,4R)-3-ethenyl-2-fluoro-N,4,5-trimethylhexan-1-amine.
| Compound Name | (3S,4R)-3-ethenyl-2-fluoro-N,4,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 174091403 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (3S,4R)-3-ethenyl-2-fluoro-N,4,5-trimethylhexan-1-amine |
| SMILES | C=C[C@H](C(F)CNC)[C@H](C)C(C)C |
| InChI | InChI=1S/C11H22FN/c1-6-10(9(4)8(2)3)11(12)7-13-5/h6,8-11,13H,1,7H2,2-5H3/t9-,10+,11?/m1/s1 |
| InChIKey | OKLQDJBDVNUDOH-JKIOLJMWSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|