C27H41B3O3 — CID 174091717
CID 174091717 (PubChem CID 174091717) has the molecular formula C27H41B3O3 and a molecular weight of 446.06 g/mol.
| Compound Name | CID 174091717 |
|---|---|
| PubChem CID | 174091717 |
| Molecular Formula | C27H41B3O3 |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | — |
| SMILES | [B]C1([B])/C(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]23)C(=C)[C@@H](O)C[C@]1([B])O |
| InChI | InChI=1S/C27H41B3O3/c1-17(8-6-14-24(3,4)32)20-12-13-22-19(9-7-15-25(20,22)5)10-11-21-18(2)23(31)16-26(28,33)27(21,29)30/h10-11,17,20,22-23,31-33H,2,6-9,12-16H2,1,3-5H3/b19-10+,21-11+/t17-,20-,22+,23+,25-,26+/m1/s1 |
| InChIKey | XRMLGJVCLDFRQA-HXRBZYDMSA-N |
| XLogP | 4.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|