C16H19N3O4S — CID 17409229
N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propylphthalazine-1-carboxamide (PubChem CID 17409229) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propylphthalazine-1-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 17409229 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-oxo-3-propylphthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)NC2CCS(=O)(=O)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C16H19N3O4S/c1-2-8-19-16(21)13-6-4-3-5-12(13)14(18-19)15(20)17-11-7-9-24(22,23)10-11/h3-6,11H,2,7-10H2,1H3,(H,17,20) |
| InChIKey | WPZNOBZWGPTZNH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |