C44H37FOPSi+ — CID 174092384
(7-fluoro-3,3-dimethyl-2,2-diphenylbenzo[g][1,2]benzoxasilol-4-yl)methyl-triphenylphosphanium (PubChem CID 174092384) has the molecular formula C44H37FOPSi+ and a molecular weight of 659.84 g/mol. Its IUPAC name is (7-fluoro-3,3-dimethyl-2,2-diphenylbenzo[g][1,2]benzoxasilol-4-yl)methyl-triphenylphosphanium.
| Compound Name | (7-fluoro-3,3-dimethyl-2,2-diphenylbenzo[g][1,2]benzoxasilol-4-yl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 174092384 |
| Molecular Formula | C44H37FOPSi+ |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | (7-fluoro-3,3-dimethyl-2,2-diphenylbenzo[g][1,2]benzoxasilol-4-yl)methyl-triphenylphosphanium |
| SMILES | CC1(C)c2c(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc3cc(F)ccc3c2O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H37FOPSi/c1-44(2)42-34(32-47(36-18-8-3-9-19-36,37-20-10-4-11-21-37)38-22-12-5-13-23-38)30-33-31-35(45)28-29-41(33)43(42)46-48(44,39-24-14-6-15-25-39)40-26-16-7-17-27-40/h3-31H,32H2,1-2H3/q+1 |
| InChIKey | YNYYNGXBERNXRZ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|