C11H20O4Si — CID 174092446
(2R,3S,4R)-2-butylsilyloxy-4-ethenoxy-3,4-dihydro-2H-pyran-3-ol (PubChem CID 174092446) has the molecular formula C11H20O4Si and a molecular weight of 244.36 g/mol. Its IUPAC name is (2R,3S,4R)-2-butylsilyloxy-4-ethenoxy-3,4-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,4R)-2-butylsilyloxy-4-ethenoxy-3,4-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 174092446 |
| Molecular Formula | C11H20O4Si |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2R,3S,4R)-2-butylsilyloxy-4-ethenoxy-3,4-dihydro-2H-pyran-3-ol |
| SMILES | C=CO[C@@H]1C=CO[C@H](O[SiH2]CCCC)[C@H]1O |
| InChI | InChI=1S/C11H20O4Si/c1-3-5-8-16-15-11-10(12)9(13-4-2)6-7-14-11/h4,6-7,9-12H,2-3,5,8,16H2,1H3/t9-,10+,11-/m1/s1 |
| InChIKey | ROVSDEKJCHFLIM-OUAUKWLOSA-N |
| XLogP | 1.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|