C54H70N9O7SSi — CID 174092523
CID 174092523 (PubChem CID 174092523) has the molecular formula C54H70N9O7SSi and a molecular weight of 1017.36 g/mol.
| Compound Name | CID 174092523 |
|---|---|
| PubChem CID | 174092523 |
| Molecular Formula | C54H70N9O7SSi |
| Molecular Weight | 1017.36 g/mol |
| Exact Mass | 1016.49 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2[C@H](C)OC)c2c3cc(ccc31)-c1nc(cs1)C[C@H](NC(=O)[C@H](C(C)C)N(C)C(=O)C1([Si])CCN(C(=O)C#CC(C)(C)N3CCC3)C1)C(=O)N1CCC[C@H](N1)C(=O)OCC(C)(C)C2 |
| InChI | InChI=1S/C54H70N9O7SSi/c1-11-62-42-18-17-35-27-38(42)39(46(62)37-15-12-22-55-44(37)34(4)69-10)29-52(5,6)32-70-50(67)40-16-13-25-63(58-40)49(66)41(28-36-30-71-48(35)56-36)57-47(65)45(33(2)3)59(9)51(68)54(72)21-26-60(31-54)43(64)19-20-53(7,8)61-23-14-24-61/h12,15,17-18,22,27,30,33-34,40-41,45,58H,11,13-14,16,21,23-26,28-29,31-32H2,1-10H3,(H,57,65)/t34-,40-,41-,45-,54?/m0/s1 |
| InChIKey | QAQBFOOEENLMOC-CFRBPQEMSA-N |
| XLogP | 5.73 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|