About (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate
(2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate (PubChem CID 17409263) has the molecular formula C17H14ClN3O4S2
and a molecular weight of 423.90 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate.
Molecular Properties
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate |
| PubChem CID | 17409263 |
| Molecular Formula | C17H14ClN3O4S2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)OCc2csc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H14ClN3O4S2/c18-15-7-6-13(27(19,23)24)8-14(15)16(22)25-9-12-10-26-17(21-12)20-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,20,21)(H2,19,23,24) |
| InChIKey | MJABWNRETOFBPB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate?
The IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate (CID 17409263) is (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate.
What is the SMILES notation for (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate?
The canonical SMILES for (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate is NS(=O)(=O)c1ccc(Cl)c(C(=O)OCc2csc(Nc3ccccc3)n2)c1.
What is the InChIKey of (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate?
The InChIKey is MJABWNRETOFBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O4S2/c18-15-7-6-13(27(19,23)24)8-14(15)16(22)25-9-12-10-26-17(21-12)20-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,20,21)(H2,19,23,24).
What are the key properties of (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate?
(2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate has a molecular weight of 423.90 g/mol, XLogP of 3.54, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-1,3-thiazol-4-yl)methyl 2-chloro-5-sulfamoylbenzoate is sourced from PubChem (CID 17409263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).