C13H22O2Si — CID 174092657
(4aS)-8a-trimethylsilyloxy-1,4a,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 174092657) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (4aS)-8a-trimethylsilyloxy-1,4a,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS)-8a-trimethylsilyloxy-1,4a,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 174092657 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (4aS)-8a-trimethylsilyloxy-1,4a,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[Si](C)(C)OC12CCCC[C@H]1C=CC(=O)C2 |
| InChI | InChI=1S/C13H22O2Si/c1-16(2,3)15-13-9-5-4-6-11(13)7-8-12(14)10-13/h7-8,11H,4-6,9-10H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | YJHAVOQLIFNBJQ-AMGKYWFPSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|