About 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate
2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate (PubChem CID 174092777) has the molecular formula C11H24N2O3Si
and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate |
| PubChem CID | 174092777 |
| Molecular Formula | C11H24N2O3Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OCC[SiH](C)C)C[C@H]1CO |
| InChI | InChI=1S/C11H24N2O3Si/c1-12-4-5-13(8-10(12)9-14)11(15)16-6-7-17(2)3/h10,14,17H,4-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | NRXXIUOBMWTUTG-JTQLQIEISA-N |
| XLogP | 0.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate?
The IUPAC name of 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate (CID 174092777) is 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate.
What is the SMILES notation for 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate?
The canonical SMILES for 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate is CN1CCN(C(=O)OCC[SiH](C)C)C[C@H]1CO.
What is the InChIKey of 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate?
The InChIKey is NRXXIUOBMWTUTG-JTQLQIEISA-N. The full InChI is InChI=1S/C11H24N2O3Si/c1-12-4-5-13(8-10(12)9-14)11(15)16-6-7-17(2)3/h10,14,17H,4-9H2,1-3H3/t10-/m0/s1.
What are the key properties of 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate?
2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate has a molecular weight of 260.41 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilylethyl (3S)-3-(hydroxymethyl)-4-methylpiperazine-1-carboxylate is sourced from PubChem (CID 174092777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).