About CID 174093006
CID 174093006 (PubChem CID 174093006) has the molecular formula C43H57BF2N4O4
and a molecular weight of 742.76 g/mol.
Molecular Properties
| Compound Name | CID 174093006 |
| PubChem CID | 174093006 |
| Molecular Formula | C43H57BF2N4O4 |
| Molecular Weight | 742.76 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | — |
| SMILES | [B]C(C(=O)OC(C)CC1C=CC(CCCCC(C)[C@@H]2CCN(C(C(=O)OC(C)(C)C)c3cc(F)cnc3C3CCC3)C2)=N1)c1cc(F)cnc1C1CCC1 |
| InChI | InChI=1S/C43H57BF2N4O4/c1-26(30-18-19-50(25-30)40(42(52)54-43(3,4)5)36-22-32(46)24-48-39(36)29-13-9-14-29)10-6-7-15-33-16-17-34(49-33)20-27(2)53-41(51)37(44)35-21-31(45)23-47-38(35)28-11-8-12-28/h16-17,21-24,26-30,34,37,40H,6-15,18-20,25H2,1-5H3/t26?,27?,30-,34?,37?,40?/m1/s1 |
| InChIKey | LDXBLVSXYQLDKZ-XTIKYLQOSA-N |
| XLogP | 8.80 |
| TPSA | 93.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 742.76 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174093006 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174093006?
The IUPAC name of CID 174093006 (CID 174093006) is not available.
What is the SMILES notation for CID 174093006?
The canonical SMILES for CID 174093006 is [B]C(C(=O)OC(C)CC1C=CC(CCCCC(C)[C@@H]2CCN(C(C(=O)OC(C)(C)C)c3cc(F)cnc3C3CCC3)C2)=N1)c1cc(F)cnc1C1CCC1.
What is the InChIKey of CID 174093006?
The InChIKey is LDXBLVSXYQLDKZ-XTIKYLQOSA-N. The full InChI is InChI=1S/C43H57BF2N4O4/c1-26(30-18-19-50(25-30)40(42(52)54-43(3,4)5)36-22-32(46)24-48-39(36)29-13-9-14-29)10-6-7-15-33-16-17-34(49-33)20-27(2)53-41(51)37(44)35-21-31(45)23-47-38(35)28-11-8-12-28/h16-17,21-24,26-30,34,37,40H,6-15,18-20,25H2,1-5H3/t26?,27?,30-,34?,37?,40?/m1/s1.
What are the key properties of CID 174093006?
CID 174093006 has a molecular weight of 742.76 g/mol, XLogP of 8.80, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174093006 is sourced from PubChem (CID 174093006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).