About 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine
2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine (PubChem CID 174093459) has the molecular formula C10H17BrN2O
and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine.
Molecular Properties
| Compound Name | 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine |
| PubChem CID | 174093459 |
| Molecular Formula | C10H17BrN2O |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine |
| SMILES | C=CC(N)=C(Br)CNC(=C)[C@H](C)OC |
| InChI | InChI=1S/C10H17BrN2O/c1-5-10(12)9(11)6-13-7(2)8(3)14-4/h5,8,13H,1-2,6,12H2,3-4H3/t8-/m0/s1 |
| InChIKey | WGQWOZKXOKJJMT-QMMMGPOBSA-N |
| XLogP | 1.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine?
The IUPAC name of 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine (CID 174093459) is 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine.
What is the SMILES notation for 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine?
The canonical SMILES for 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine is C=CC(N)=C(Br)CNC(=C)[C@H](C)OC.
What is the InChIKey of 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine?
The InChIKey is WGQWOZKXOKJJMT-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H17BrN2O/c1-5-10(12)9(11)6-13-7(2)8(3)14-4/h5,8,13H,1-2,6,12H2,3-4H3/t8-/m0/s1.
What are the key properties of 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine?
2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine has a molecular weight of 261.16 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-N-[(3S)-3-methoxybut-1-en-2-yl]penta-2,4-diene-1,3-diamine is sourced from PubChem (CID 174093459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).