C15H23N3 — CID 174093674
(2E)-N'-[[ethenyl(ethyl)amino]methyl]-3,4-dimethyl-N-prop-2-ynylpenta-2,4-dienimidamide (PubChem CID 174093674) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (2E)-N'-[[ethenyl(ethyl)amino]methyl]-3,4-dimethyl-N-prop-2-ynylpenta-2,4-dienimidamide.
| Compound Name | (2E)-N'-[[ethenyl(ethyl)amino]methyl]-3,4-dimethyl-N-prop-2-ynylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 174093674 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (2E)-N'-[[ethenyl(ethyl)amino]methyl]-3,4-dimethyl-N-prop-2-ynylpenta-2,4-dienimidamide |
| SMILES | C#CCNC(/C=C(\C)C(=C)C)=NCN(C=C)CC |
| InChI | InChI=1S/C15H23N3/c1-7-10-16-15(11-14(6)13(4)5)17-12-18(8-2)9-3/h1,8,11H,2,4,9-10,12H2,3,5-6H3,(H,16,17)/b14-11+ |
| InChIKey | RTGUSKWJVGAVPD-SDNWHVSQSA-N |
| XLogP | 2.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|