C14H21NO — CID 174094021
(2S,3E,6Z)-3-formyl-2-methyl-5-(2-methylpropyl)octa-3,6-dienenitrile (PubChem CID 174094021) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (2S,3E,6Z)-3-formyl-2-methyl-5-(2-methylpropyl)octa-3,6-dienenitrile.
| Compound Name | (2S,3E,6Z)-3-formyl-2-methyl-5-(2-methylpropyl)octa-3,6-dienenitrile |
|---|---|
| PubChem CID | 174094021 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2S,3E,6Z)-3-formyl-2-methyl-5-(2-methylpropyl)octa-3,6-dienenitrile |
| SMILES | C/C=C\C(/C=C(/C=O)C(C)C#N)CC(C)C |
| InChI | InChI=1S/C14H21NO/c1-5-6-13(7-11(2)3)8-14(10-16)12(4)9-15/h5-6,8,10-13H,7H2,1-4H3/b6-5-,14-8- |
| InChIKey | QJMUABIJYNSWFB-DICXBPMKSA-N |
| XLogP | 3.51 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|