C14H26O6 — CID 174094136
[(3S,6R,7S)-4-hydroxy-6-(hydroxymethyl)-7-propan-2-yl-3-propan-2-yloxyoxepan-2-yl] formate (PubChem CID 174094136) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(3S,6R,7S)-4-hydroxy-6-(hydroxymethyl)-7-propan-2-yl-3-propan-2-yloxyoxepan-2-yl] formate.
| Compound Name | [(3S,6R,7S)-4-hydroxy-6-(hydroxymethyl)-7-propan-2-yl-3-propan-2-yloxyoxepan-2-yl] formate |
|---|---|
| PubChem CID | 174094136 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [(3S,6R,7S)-4-hydroxy-6-(hydroxymethyl)-7-propan-2-yl-3-propan-2-yloxyoxepan-2-yl] formate |
| SMILES | CC(C)O[C@H]1C(O)C[C@H](CO)[C@H](C(C)C)OC1OC=O |
| InChI | InChI=1S/C14H26O6/c1-8(2)12-10(6-15)5-11(17)13(19-9(3)4)14(20-12)18-7-16/h7-15,17H,5-6H2,1-4H3/t10-,11?,12+,13+,14?/m1/s1 |
| InChIKey | ARJPKMCPQQPKGS-RNVCYNIRSA-N |
| XLogP | 0.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|