About 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine
4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine (PubChem CID 174094301) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine.
Molecular Properties
| Compound Name | 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine |
| PubChem CID | 174094301 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine |
| SMILES | C/N=C(\C=C(C)N)[C@H]1CC[C@H](C)CN1 |
| InChI | InChI=1S/C11H21N3/c1-8-4-5-10(14-7-8)11(13-3)6-9(2)12/h6,8,10,14H,4-5,7,12H2,1-3H3/b9-6?,13-11+/t8-,10+/m0/s1 |
| InChIKey | JMWIVTFYOQWEJW-RZOAGQGKSA-N |
| XLogP | 1.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine?
The IUPAC name of 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine (CID 174094301) is 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine.
What is the SMILES notation for 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine?
The canonical SMILES for 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine is C/N=C(\C=C(C)N)[C@H]1CC[C@H](C)CN1.
What is the InChIKey of 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine?
The InChIKey is JMWIVTFYOQWEJW-RZOAGQGKSA-N. The full InChI is InChI=1S/C11H21N3/c1-8-4-5-10(14-7-8)11(13-3)6-9(2)12/h6,8,10,14H,4-5,7,12H2,1-3H3/b9-6?,13-11+/t8-,10+/m0/s1.
What are the key properties of 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine?
4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylimino-4-[(2R,5S)-5-methylpiperidin-2-yl]but-2-en-2-amine is sourced from PubChem (CID 174094301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).