About CID 174094412
CID 174094412 (PubChem CID 174094412) has the molecular formula C29H25BCl2N8O5
and a molecular weight of 647.29 g/mol.
Molecular Properties
| Compound Name | CID 174094412 |
| PubChem CID | 174094412 |
| Molecular Formula | C29H25BCl2N8O5 |
| Molecular Weight | 647.29 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)N=Cc1cc(NC(=O)C(Cc2ccccc2)N2CC(=O)N(c3cc(Cl)ccc3-n3cc(Cl)nn3)CC2=O)ccc1N |
| InChI | InChI=1S/C29H25BCl2N8O5/c30-29(44,45)34-13-18-11-20(7-8-21(18)33)35-28(43)24(10-17-4-2-1-3-5-17)39-16-26(41)38(15-27(39)42)23-12-19(31)6-9-22(23)40-14-25(32)36-37-40/h1-9,11-14,24,44-45H,10,15-16,33H2,(H,35,43) |
| InChIKey | RXCGPNLBKIHBEO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 179.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 647.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 174094412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174094412?
The IUPAC name of CID 174094412 (CID 174094412) is not available.
What is the SMILES notation for CID 174094412?
The canonical SMILES for CID 174094412 is [B]C(O)(O)N=Cc1cc(NC(=O)C(Cc2ccccc2)N2CC(=O)N(c3cc(Cl)ccc3-n3cc(Cl)nn3)CC2=O)ccc1N.
What is the InChIKey of CID 174094412?
The InChIKey is RXCGPNLBKIHBEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25BCl2N8O5/c30-29(44,45)34-13-18-11-20(7-8-21(18)33)35-28(43)24(10-17-4-2-1-3-5-17)39-16-26(41)38(15-27(39)42)23-12-19(31)6-9-22(23)40-14-25(32)36-37-40/h1-9,11-14,24,44-45H,10,15-16,33H2,(H,35,43).
What are the key properties of CID 174094412?
CID 174094412 has a molecular weight of 647.29 g/mol, XLogP of 1.76, 9 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174094412 is sourced from PubChem (CID 174094412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).