C17H19BN5O8PS — CID 174094843
[2-[[9-[(6R,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanylmethyl]phenyl]boronic acid (PubChem CID 174094843) has the molecular formula C17H19BN5O8PS and a molecular weight of 495.22 g/mol. Its IUPAC name is [2-[[9-[(6R,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [2-[[9-[(6R,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174094843 |
| Molecular Formula | C17H19BN5O8PS |
| Molecular Weight | 495.22 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [2-[[9-[(6R,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanylmethyl]phenyl]boronic acid |
| SMILES | Nc1nc2c(nc(SCc3ccccc3B(O)O)n2[C@@H]2OC3COP(O)O[C@H]3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H19BN5O8PS/c19-16-21-13-10(14(25)22-16)20-17(33-6-7-3-1-2-4-8(7)18(26)27)23(13)15-11(24)12-9(30-15)5-29-32(28)31-12/h1-4,9,11-12,15,24,26-28H,5-6H2,(H3,19,21,22,25)/t9?,11?,12-,15-,32?/m1/s1 |
| InChIKey | ZGQPGILBLWZHEJ-SZKCVBJDSA-N |
| XLogP | -1.43 |
| TPSA | 198.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|