C23H22BClN8S — CID 174094851
CID 174094851 (PubChem CID 174094851) has the molecular formula C23H22BClN8S and a molecular weight of 488.82 g/mol.
| Compound Name | CID 174094851 |
|---|---|
| PubChem CID | 174094851 |
| Molecular Formula | C23H22BClN8S |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | — |
| SMILES | [B]c1cn2c(N3CCC4(CC3)Cc3ncccc3C4N)ncc(Sc3ccnc(N)c3Cl)c2n1 |
| InChI | InChI=1S/C23H22BClN8S/c24-17-12-33-21(31-17)16(34-15-3-7-29-20(27)18(15)25)11-30-22(33)32-8-4-23(5-9-32)10-14-13(19(23)26)2-1-6-28-14/h1-3,6-7,11-12,19H,4-5,8-10,26H2,(H2,27,29) |
| InChIKey | ZGCKVRCIKSIAIF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|