C25H23B3F2N4O3 — CID 174095072
CID 174095072 (PubChem CID 174095072) has the molecular formula C25H23B3F2N4O3 and a molecular weight of 497.92 g/mol.
| Compound Name | CID 174095072 |
|---|---|
| PubChem CID | 174095072 |
| Molecular Formula | C25H23B3F2N4O3 |
| Molecular Weight | 497.92 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1ccc2c(c1)nc(-c1c(F)cc(N3CCCC3=O)cc1F)n2C[C@H]1CN(C(C)=O)CCO1 |
| InChI | InChI=1S/C25H23B3F2N4O3/c1-14(35)32-7-8-37-17(12-32)13-34-21-5-4-15(25(26,27)28)9-20(21)31-24(34)23-18(29)10-16(11-19(23)30)33-6-2-3-22(33)36/h4-5,9-11,17H,2-3,6-8,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | BTPGOVXEDDRGRJ-QGZVFWFLSA-N |
| XLogP | 1.97 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.92 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|