C21H22N5O6PS — CID 174095089
3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-propylsulfanyl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 174095089) has the molecular formula C21H22N5O6PS and a molecular weight of 503.48 g/mol. Its IUPAC name is 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-propylsulfanyl-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-propylsulfanyl-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 174095089 |
| Molecular Formula | C21H22N5O6PS |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-propylsulfanyl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | CCCSc1nc2c(=O)n3cc(-c4ccccc4)[nH]c3nc2n1[C@@H]1OC2COP(O)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C21H22N5O6PS/c1-2-8-34-21-23-14-17(26(21)19-15(27)16-13(31-19)10-30-33(29)32-16)24-20-22-12(9-25(20)18(14)28)11-6-4-3-5-7-11/h3-7,9,13,15-16,19,27,29H,2,8,10H2,1H3,(H,22,24)/t13?,15-,16+,19+,33?/m0/s1 |
| InChIKey | LUOBCERBCQDAAG-DOINORBXSA-N |
| XLogP | 2.43 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|