About (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide
(2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide (PubChem CID 174095535) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide |
| PubChem CID | 174095535 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide |
| SMILES | [H]/N=C/C(/C=N/C)=C(N)/C=C\C(N)=N\C |
| InChI | InChI=1S/C9H15N5/c1-13-6-7(5-10)8(11)3-4-9(12)14-2/h3-6,10H,11H2,1-2H3,(H2,12,14)/b4-3-,8-7?,10-5+,13-6+ |
| InChIKey | FTLSNHNLPUIFAP-JYPGWCLHSA-N |
| XLogP | 0.09 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide?
The IUPAC name of (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide (CID 174095535) is (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide.
What is the SMILES notation for (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide?
The canonical SMILES for (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide is [H]/N=C/C(/C=N/C)=C(N)/C=C\C(N)=N\C.
What is the InChIKey of (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide?
The InChIKey is FTLSNHNLPUIFAP-JYPGWCLHSA-N. The full InChI is InChI=1S/C9H15N5/c1-13-6-7(5-10)8(11)3-4-9(12)14-2/h3-6,10H,11H2,1-2H3,(H2,12,14)/b4-3-,8-7?,10-5+,13-6+.
What are the key properties of (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide?
(2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide has a molecular weight of 193.25 g/mol, XLogP of 0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4-amino-5-methanimidoyl-N'-methyl-6-methyliminohexa-2,4-dienimidamide is sourced from PubChem (CID 174095535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).