C18H26BF7O2 — CID 174095542
4,4,5,5-tetramethyl-2-[(3Z,5Z)-9,10,10,10-tetrafluoro-2-methyl-9-(trifluoromethyl)deca-3,5-dien-5-yl]-1,3,2-dioxaborolane (PubChem CID 174095542) has the molecular formula C18H26BF7O2 and a molecular weight of 418.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(3Z,5Z)-9,10,10,10-tetrafluoro-2-methyl-9-(trifluoromethyl)deca-3,5-dien-5-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(3Z,5Z)-9,10,10,10-tetrafluoro-2-methyl-9-(trifluoromethyl)deca-3,5-dien-5-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174095542 |
| Molecular Formula | C18H26BF7O2 |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(3Z,5Z)-9,10,10,10-tetrafluoro-2-methyl-9-(trifluoromethyl)deca-3,5-dien-5-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)/C=C\C(=C/CCC(F)(C(F)(F)F)C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BF7O2/c1-12(2)9-10-13(19-27-14(3,4)15(5,6)28-19)8-7-11-16(20,17(21,22)23)18(24,25)26/h8-10,12H,7,11H2,1-6H3/b10-9-,13-8+ |
| InChIKey | RPWRBUCPMLOZOU-ZSEITYQVSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|