C20H37NO — CID 174095582
(7Z,9Z)-10,12-dimethyl-14-[methyl(propan-2-yl)amino]tetradeca-7,9-dienal (PubChem CID 174095582) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is (7Z,9Z)-10,12-dimethyl-14-[methyl(propan-2-yl)amino]tetradeca-7,9-dienal.
| Compound Name | (7Z,9Z)-10,12-dimethyl-14-[methyl(propan-2-yl)amino]tetradeca-7,9-dienal |
|---|---|
| PubChem CID | 174095582 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (7Z,9Z)-10,12-dimethyl-14-[methyl(propan-2-yl)amino]tetradeca-7,9-dienal |
| SMILES | C/C(=C/C=C\CCCCCC=O)CC(C)CCN(C)C(C)C |
| InChI | InChI=1S/C20H37NO/c1-18(2)21(5)15-14-20(4)17-19(3)13-11-9-7-6-8-10-12-16-22/h9,11,13,16,18,20H,6-8,10,12,14-15,17H2,1-5H3/b11-9-,19-13- |
| InChIKey | ITGKZYKTSIQWLM-NHJGUPFESA-N |
| XLogP | 5.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|