About methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate
methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate (PubChem CID 174095945) has the molecular formula C8H13ClN6OS
and a molecular weight of 276.75 g/mol. Its IUPAC name is methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate |
| PubChem CID | 174095945 |
| Molecular Formula | C8H13ClN6OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate |
| SMILES | [H]/N=C(/NC(=O)C(=NC(Cl)=C(N)N)C(=C)N)SC |
| InChI | InChI=1S/C8H13ClN6OS/c1-3(10)4(14-5(9)6(11)12)7(16)15-8(13)17-2/h1,10-12H2,2H3,(H2,13,15,16) |
| InChIKey | KPYIZAOQPMZWKP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate?
The IUPAC name of methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate (CID 174095945) is methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate.
What is the SMILES notation for methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate?
The canonical SMILES for methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate is [H]/N=C(/NC(=O)C(=NC(Cl)=C(N)N)C(=C)N)SC.
What is the InChIKey of methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate?
The InChIKey is KPYIZAOQPMZWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN6OS/c1-3(10)4(14-5(9)6(11)12)7(16)15-8(13)17-2/h1,10-12H2,2H3,(H2,13,15,16).
What are the key properties of methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate?
methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate has a molecular weight of 276.75 g/mol, XLogP of -0.40, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-amino-2-(2,2-diamino-1-chloroethenyl)iminobut-3-enoyl]carbamimidothioate is sourced from PubChem (CID 174095945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).