C18H9B3ClN — CID 174096780
CID 174096780 (PubChem CID 174096780) has the molecular formula C18H9B3ClN and a molecular weight of 307.17 g/mol.
| Compound Name | CID 174096780 |
|---|---|
| PubChem CID | 174096780 |
| Molecular Formula | C18H9B3ClN |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | — |
| SMILES | [B]c1c(Cl)c([B])c2c3ccccc3n(-c3ccccc3)c2c1[B] |
| InChI | InChI=1S/C18H9B3ClN/c19-14-13-11-8-4-5-9-12(11)23(10-6-2-1-3-7-10)18(13)16(21)15(20)17(14)22/h1-9H |
| InChIKey | FHCXLGLQKRHSSH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|