C19H29BN2O2S — CID 174097116
(7R)-3-[3-(1-methylazetidin-3-yl)cyclobutyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thia-4-azabicyclo[3.2.0]hepta-1(5),3-diene (PubChem CID 174097116) has the molecular formula C19H29BN2O2S and a molecular weight of 360.33 g/mol. Its IUPAC name is (7R)-3-[3-(1-methylazetidin-3-yl)cyclobutyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thia-4-azabicyclo[3.2.0]hepta-1(5),3-diene.
| Compound Name | (7R)-3-[3-(1-methylazetidin-3-yl)cyclobutyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thia-4-azabicyclo[3.2.0]hepta-1(5),3-diene |
|---|---|
| PubChem CID | 174097116 |
| Molecular Formula | C19H29BN2O2S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (7R)-3-[3-(1-methylazetidin-3-yl)cyclobutyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thia-4-azabicyclo[3.2.0]hepta-1(5),3-diene |
| SMILES | CN1CC(C2CC(c3nc4c(s3)[C@H](B3OC(C)(C)C(C)(C)O3)C4)C2)C1 |
| InChI | InChI=1S/C19H29BN2O2S/c1-18(2)19(3,4)24-20(23-18)14-8-15-16(14)25-17(21-15)12-6-11(7-12)13-9-22(5)10-13/h11-14H,6-10H2,1-5H3/t11?,12?,14-/m1/s1 |
| InChIKey | WFQGCWUPFPHMCK-ORHYLEIMSA-N |
| XLogP | 3.47 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|